1-Pentene, 2,4-dimethyl- (8CI)(9CI)
2,4-Dimethyl-1-pentene
CAS: 2213-32-3
Molecular Formula: C7H14
1-Pentene, 2,4-dimethyl- (8CI)(9CI) - Names and Identifiers
| Name | 2,4-Dimethyl-1-pentene |
| Synonyms | NSC 74135 2,4-Dimethylpent-1-ene 2,4-Dimethyl-1-pentene 2,4-DIMETHYL-1-PENTENE 2,4-dimethyl-pent-1-ene 1-Pentene, 2,4-dimethyl- 2,4,4-TRIMETHYL-1-BUTENE 1-Pentene, 2,4-dimethyl- (8CI)(9CI) |
| CAS | 2213-32-3 |
| EINECS | 218-665-2 |
| InChI | InChI=1/C7H14/c1-6(2)5-7(3)4/h7H,1,5H2,2-4H3 |
1-Pentene, 2,4-dimethyl- (8CI)(9CI) - Physico-chemical Properties
| Molecular Formula | C7H14 |
| Molar Mass | 98.19 |
| Density | 0,69 g/cm3 |
| Melting Point | -124.06°C |
| Boling Point | 81°C |
| Flash Point | -16°C |
| Vapor Presure | 78.8mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Almost colorless |
| Storage Condition | Room Temprature |
| Refractive Index | 1.3995 |
| MDL | MFCD00039854 |
1-Pentene, 2,4-dimethyl- (8CI)(9CI) - Risk and Safety
| Risk Codes | 11 - Highly Flammable |
| Safety Description | S3/7 - S9 - Keep container in a well-ventilated place. S16 - Keep away from sources of ignition. S29 - Do not empty into drains. S33 - Take precautionary measures against static discharges. |
| UN IDs | 3295 |
| Hazard Class | 3 |
| Packing Group | II |
1-Pentene, 2,4-dimethyl- (8CI)(9CI) - Introduction
2,4-dimethyl-1-pentene is an organic compound with the chemical formula C7H14. It is a colorless liquid with a special smell. The following is a description of the nature, use, preparation and safety information of 2,4-dimenthyl-1-pentene:
Nature:
1. Appearance: colorless liquid
2. Boiling Point: about 115-118 ° C
3. Density: about 0.681 g/cm
4. Solubility: Soluble in alcohol and ether solvents, low solubility with water
5. Flammability: has a low flash point, need to be stored and Operation pay attention to fire
Use:
2,4-dimethyl-1-pentene has many uses in the chemical industry:
1. As a solvent: Due to its good solubility, it can be used as a solvent and extractant in organic synthesis reactions;
2. Commonly used in polymer synthesis: can be used as part of the polymerization reaction monomer or copolymerization reaction;
3. For the preparation of other compounds: can be used as a raw material for the synthesis of other chemicals.
Method:
2,4-dimethyl-1-pentene is usually prepared by the following methods:
1. Generated in the thermal cracking process of alkanes, such as naphtha or kerosene cracking products may contain the compound;
2. Obtain by methylation reaction of 1-pentene.
Safety Information:
1. 2,4-dimethyl-1-pentene is irritating and may cause irritation to the eyes, skin, and respiratory system. Wear appropriate protective equipment when using.
2. Due to its flammability, avoid contact with open flames or high-temperature substances, and store in a cool and well-ventilated place.
3. In the use or handling of the compound, should follow the relevant safety procedures.
4. If the compound is accidentally inhaled, exposed or ingested, seek medical attention immediately and bring information about the compound.
Please note that the relevant nature, use, formulation and safety information of 2,4-dimenthyl-1-pentene may vary slightly from source to source. The above information is for reference only, and the specific instructions and relevant safety information of the product should be carefully read before use.
Nature:
1. Appearance: colorless liquid
2. Boiling Point: about 115-118 ° C
3. Density: about 0.681 g/cm
4. Solubility: Soluble in alcohol and ether solvents, low solubility with water
5. Flammability: has a low flash point, need to be stored and Operation pay attention to fire
Use:
2,4-dimethyl-1-pentene has many uses in the chemical industry:
1. As a solvent: Due to its good solubility, it can be used as a solvent and extractant in organic synthesis reactions;
2. Commonly used in polymer synthesis: can be used as part of the polymerization reaction monomer or copolymerization reaction;
3. For the preparation of other compounds: can be used as a raw material for the synthesis of other chemicals.
Method:
2,4-dimethyl-1-pentene is usually prepared by the following methods:
1. Generated in the thermal cracking process of alkanes, such as naphtha or kerosene cracking products may contain the compound;
2. Obtain by methylation reaction of 1-pentene.
Safety Information:
1. 2,4-dimethyl-1-pentene is irritating and may cause irritation to the eyes, skin, and respiratory system. Wear appropriate protective equipment when using.
2. Due to its flammability, avoid contact with open flames or high-temperature substances, and store in a cool and well-ventilated place.
3. In the use or handling of the compound, should follow the relevant safety procedures.
4. If the compound is accidentally inhaled, exposed or ingested, seek medical attention immediately and bring information about the compound.
Please note that the relevant nature, use, formulation and safety information of 2,4-dimenthyl-1-pentene may vary slightly from source to source. The above information is for reference only, and the specific instructions and relevant safety information of the product should be carefully read before use.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: 2,4-Dimethyl-1-Pentene Visit Supplier Webpage Request for quotation
CAS: 2213-32-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 2213-32-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2,4-Dimethyl-1-Pentene Visit Supplier Webpage Request for quotation
CAS: 2213-32-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 2213-32-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History